C26H23NO5 — CID 108799946
N-(2,4-dimethoxyphenyl)-4-(6,8-dimethyl-4-oxochromen-2-yl)benzamide (PubChem CID 108799946) has the molecular formula C26H23NO5 and a molecular weight of 429.47 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-4-(6,8-dimethyl-4-oxochromen-2-yl)benzamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-4-(6,8-dimethyl-4-oxochromen-2-yl)benzamide |
|---|---|
| PubChem CID | 108799946 |
| Molecular Formula | C26H23NO5 |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-4-(6,8-dimethyl-4-oxochromen-2-yl)benzamide |
| SMILES | COc1ccc(NC(=O)c2ccc(-c3cc(=O)c4cc(C)cc(C)c4o3)cc2)c(OC)c1 |
| InChI | InChI=1S/C26H23NO5/c1-15-11-16(2)25-20(12-15)22(28)14-23(32-25)17-5-7-18(8-6-17)26(29)27-21-10-9-19(30-3)13-24(21)31-4/h5-14H,1-4H3,(H,27,29) |
| InChIKey | FJSGXDMCUCTZMT-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |