C25H20BrNO3 — CID 108799914
N-(4-bromo-2-methylphenyl)-4-(6,8-dimethyl-4-oxochromen-2-yl)benzamide (PubChem CID 108799914) has the molecular formula C25H20BrNO3 and a molecular weight of 462.34 g/mol. Its IUPAC name is N-(4-bromo-2-methylphenyl)-4-(6,8-dimethyl-4-oxochromen-2-yl)benzamide.
| Compound Name | N-(4-bromo-2-methylphenyl)-4-(6,8-dimethyl-4-oxochromen-2-yl)benzamide |
|---|---|
| PubChem CID | 108799914 |
| Molecular Formula | C25H20BrNO3 |
| Molecular Weight | 462.34 g/mol |
| Exact Mass | 461.06 |
| IUPAC Name | N-(4-bromo-2-methylphenyl)-4-(6,8-dimethyl-4-oxochromen-2-yl)benzamide |
| SMILES | Cc1cc(C)c2oc(-c3ccc(C(=O)Nc4ccc(Br)cc4C)cc3)cc(=O)c2c1 |
| InChI | InChI=1S/C25H20BrNO3/c1-14-10-16(3)24-20(11-14)22(28)13-23(30-24)17-4-6-18(7-5-17)25(29)27-21-9-8-19(26)12-15(21)2/h4-13H,1-3H3,(H,27,29) |
| InChIKey | LOXAVGCIXCAULU-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.34 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |