C26H24N2O5S — CID 108799991
4-(6,8-dimethyl-4-oxochromen-2-yl)-N-[4-(dimethylsulfamoyl)phenyl]benzamide (PubChem CID 108799991) has the molecular formula C26H24N2O5S and a molecular weight of 476.55 g/mol. Its IUPAC name is 4-(6,8-dimethyl-4-oxochromen-2-yl)-N-[4-(dimethylsulfamoyl)phenyl]benzamide.
| Compound Name | 4-(6,8-dimethyl-4-oxochromen-2-yl)-N-[4-(dimethylsulfamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 108799991 |
| Molecular Formula | C26H24N2O5S |
| Molecular Weight | 476.55 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | 4-(6,8-dimethyl-4-oxochromen-2-yl)-N-[4-(dimethylsulfamoyl)phenyl]benzamide |
| SMILES | Cc1cc(C)c2oc(-c3ccc(C(=O)Nc4ccc(S(=O)(=O)N(C)C)cc4)cc3)cc(=O)c2c1 |
| InChI | InChI=1S/C26H24N2O5S/c1-16-13-17(2)25-22(14-16)23(29)15-24(33-25)18-5-7-19(8-6-18)26(30)27-20-9-11-21(12-10-20)34(31,32)28(3)4/h5-15H,1-4H3,(H,27,30) |
| InChIKey | LQPBMDPDYIXSCY-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.55 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |