C24H17F2NO3 — CID 108787054
N-(2,6-difluorophenyl)-4-(6,8-dimethyl-4-oxochromen-2-yl)benzamide (PubChem CID 108787054) has the molecular formula C24H17F2NO3 and a molecular weight of 405.40 g/mol. Its IUPAC name is N-(2,6-difluorophenyl)-4-(6,8-dimethyl-4-oxochromen-2-yl)benzamide.
| Compound Name | N-(2,6-difluorophenyl)-4-(6,8-dimethyl-4-oxochromen-2-yl)benzamide |
|---|---|
| PubChem CID | 108787054 |
| Molecular Formula | C24H17F2NO3 |
| Molecular Weight | 405.40 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | N-(2,6-difluorophenyl)-4-(6,8-dimethyl-4-oxochromen-2-yl)benzamide |
| SMILES | Cc1cc(C)c2oc(-c3ccc(C(=O)Nc4c(F)cccc4F)cc3)cc(=O)c2c1 |
| InChI | InChI=1S/C24H17F2NO3/c1-13-10-14(2)23-17(11-13)20(28)12-21(30-23)15-6-8-16(9-7-15)24(29)27-22-18(25)4-3-5-19(22)26/h3-12H,1-2H3,(H,27,29) |
| InChIKey | NMTCXPGQBLNNLT-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.40 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |