C24H18BrNO3 — CID 108786947
N-(4-bromophenyl)-4-(6,8-dimethyl-4-oxochromen-2-yl)benzamide (PubChem CID 108786947) has the molecular formula C24H18BrNO3 and a molecular weight of 448.32 g/mol. Its IUPAC name is N-(4-bromophenyl)-4-(6,8-dimethyl-4-oxochromen-2-yl)benzamide.
| Compound Name | N-(4-bromophenyl)-4-(6,8-dimethyl-4-oxochromen-2-yl)benzamide |
|---|---|
| PubChem CID | 108786947 |
| Molecular Formula | C24H18BrNO3 |
| Molecular Weight | 448.32 g/mol |
| Exact Mass | 447.05 |
| IUPAC Name | N-(4-bromophenyl)-4-(6,8-dimethyl-4-oxochromen-2-yl)benzamide |
| SMILES | Cc1cc(C)c2oc(-c3ccc(C(=O)Nc4ccc(Br)cc4)cc3)cc(=O)c2c1 |
| InChI | InChI=1S/C24H18BrNO3/c1-14-11-15(2)23-20(12-14)21(27)13-22(29-23)16-3-5-17(6-4-16)24(28)26-19-9-7-18(25)8-10-19/h3-13H,1-2H3,(H,26,28) |
| InChIKey | YTCFSPQKXRXCMR-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.32 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |