C22H23NO3 — CID 108787059
N-tert-butyl-4-(6,8-dimethyl-4-oxochromen-2-yl)benzamide (PubChem CID 108787059) has the molecular formula C22H23NO3 and a molecular weight of 349.43 g/mol. Its IUPAC name is N-tert-butyl-4-(6,8-dimethyl-4-oxochromen-2-yl)benzamide.
| Compound Name | N-tert-butyl-4-(6,8-dimethyl-4-oxochromen-2-yl)benzamide |
|---|---|
| PubChem CID | 108787059 |
| Molecular Formula | C22H23NO3 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | N-tert-butyl-4-(6,8-dimethyl-4-oxochromen-2-yl)benzamide |
| SMILES | Cc1cc(C)c2oc(-c3ccc(C(=O)NC(C)(C)C)cc3)cc(=O)c2c1 |
| InChI | InChI=1S/C22H23NO3/c1-13-10-14(2)20-17(11-13)18(24)12-19(26-20)15-6-8-16(9-7-15)21(25)23-22(3,4)5/h6-12H,1-5H3,(H,23,25) |
| InChIKey | YRBSLMBQOQNUFM-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |