C26H23NO3 — CID 108787032
4-(6,8-dimethyl-4-oxochromen-2-yl)-N-(2,3-dimethylphenyl)benzamide (PubChem CID 108787032) has the molecular formula C26H23NO3 and a molecular weight of 397.47 g/mol. Its IUPAC name is 4-(6,8-dimethyl-4-oxochromen-2-yl)-N-(2,3-dimethylphenyl)benzamide.
| Compound Name | 4-(6,8-dimethyl-4-oxochromen-2-yl)-N-(2,3-dimethylphenyl)benzamide |
|---|---|
| PubChem CID | 108787032 |
| Molecular Formula | C26H23NO3 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | 4-(6,8-dimethyl-4-oxochromen-2-yl)-N-(2,3-dimethylphenyl)benzamide |
| SMILES | Cc1cc(C)c2oc(-c3ccc(C(=O)Nc4cccc(C)c4C)cc3)cc(=O)c2c1 |
| InChI | InChI=1S/C26H23NO3/c1-15-12-17(3)25-21(13-15)23(28)14-24(30-25)19-8-10-20(11-9-19)26(29)27-22-7-5-6-16(2)18(22)4/h5-14H,1-4H3,(H,27,29) |
| InChIKey | XNQOFXYYKIXGLM-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |