C25H25N3O3 — CID 10884201
N-[(Z)-[5,7-dimethoxy-3-(4-methoxyphenyl)-1-methylquinolin-2-ylidene]amino]aniline (PubChem CID 10884201) has the molecular formula C25H25N3O3 and a molecular weight of 415.49 g/mol. Its IUPAC name is N-[(Z)-[5,7-dimethoxy-3-(4-methoxyphenyl)-1-methylquinolin-2-ylidene]amino]aniline.
| Compound Name | N-[(Z)-[5,7-dimethoxy-3-(4-methoxyphenyl)-1-methylquinolin-2-ylidene]amino]aniline |
|---|---|
| PubChem CID | 10884201 |
| Molecular Formula | C25H25N3O3 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | N-[(Z)-[5,7-dimethoxy-3-(4-methoxyphenyl)-1-methylquinolin-2-ylidene]amino]aniline |
| SMILES | COc1ccc(-c2cc3c(OC)cc(OC)cc3n(C)/c2=N\Nc2ccccc2)cc1 |
| InChI | InChI=1S/C25H25N3O3/c1-28-23-14-20(30-3)15-24(31-4)22(23)16-21(17-10-12-19(29-2)13-11-17)25(28)27-26-18-8-6-5-7-9-18/h5-16,26H,1-4H3/b27-25- |
| InChIKey | AGFRIFGJACNPFZ-RFBIWTDZSA-N |
| XLogP | 4.80 |
| TPSA | 57.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|