C12H13N3S — CID 4309192
N-(cyclopentylideneamino)-1,3-benzothiazol-2-amine (PubChem CID 4309192) has the molecular formula C12H13N3S and a molecular weight of 231.32 g/mol. Its IUPAC name is N-(cyclopentylideneamino)-1,3-benzothiazol-2-amine.
| Compound Name | N-(cyclopentylideneamino)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 4309192 |
| Molecular Formula | C12H13N3S |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | N-(cyclopentylideneamino)-1,3-benzothiazol-2-amine |
| SMILES | c1ccc2sc(NN=C3CCCC3)nc2c1 |
| InChI | InChI=1S/C12H13N3S/c1-2-6-9(5-1)14-15-12-13-10-7-3-4-8-11(10)16-12/h3-4,7-8H,1-2,5-6H2,(H,13,15) |
| InChIKey | IPSWZQGHBLDAKY-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|