C17H11ClN4OS2 — CID 136822931
(5E)-2-(1,3-benzothiazol-2-ylhydrazinylidene)-5-[(4-chlorophenyl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 136822931) has the molecular formula C17H11ClN4OS2 and a molecular weight of 386.89 g/mol. Its IUPAC name is (5E)-2-(1,3-benzothiazol-2-ylhydrazinylidene)-5-[(4-chlorophenyl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5E)-2-(1,3-benzothiazol-2-ylhydrazinylidene)-5-[(4-chlorophenyl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 136822931 |
| Molecular Formula | C17H11ClN4OS2 |
| Molecular Weight | 386.89 g/mol |
| Exact Mass | 386.01 |
| IUPAC Name | (5E)-2-(1,3-benzothiazol-2-ylhydrazinylidene)-5-[(4-chlorophenyl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1NC(=NNc2nc3ccccc3s2)S/C1=C/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H11ClN4OS2/c18-11-7-5-10(6-8-11)9-14-15(23)20-17(25-14)22-21-16-19-12-3-1-2-4-13(12)24-16/h1-9H,(H,19,21)(H,20,22,23)/b14-9+ |
| InChIKey | OLXDKKKQAINMCG-NTEUORMPSA-N |
| XLogP | 4.54 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.89 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|