C23H15N3O4S2 — CID 166630289
N-(1,3-benzothiazol-2-yl)-2-[6-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]naphthalen-2-yl]oxyacetamide (PubChem CID 166630289) has the molecular formula C23H15N3O4S2 and a molecular weight of 461.52 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-2-[6-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]naphthalen-2-yl]oxyacetamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-2-[6-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]naphthalen-2-yl]oxyacetamide |
|---|---|
| PubChem CID | 166630289 |
| Molecular Formula | C23H15N3O4S2 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.05 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-2-[6-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]naphthalen-2-yl]oxyacetamide |
| SMILES | O=C(COc1ccc2cc(/C=C3/SC(=O)NC3=O)ccc2c1)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C23H15N3O4S2/c27-20(25-22-24-17-3-1-2-4-18(17)31-22)12-30-16-8-7-14-9-13(5-6-15(14)11-16)10-19-21(28)26-23(29)32-19/h1-11H,12H2,(H,24,25,27)(H,26,28,29)/b19-10+ |
| InChIKey | IYQTWZLKOHLGIY-VXLYETTFSA-N |
| XLogP | 4.79 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|