C20H16N2O7S — CID 91755034
2-[4-[[2-[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetyl]amino]phenoxy]acetic acid (PubChem CID 91755034) has the molecular formula C20H16N2O7S and a molecular weight of 428.42 g/mol. Its IUPAC name is 2-[4-[[2-[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetyl]amino]phenoxy]acetic acid.
| Compound Name | 2-[4-[[2-[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetyl]amino]phenoxy]acetic acid |
|---|---|
| PubChem CID | 91755034 |
| Molecular Formula | C20H16N2O7S |
| Molecular Weight | 428.42 g/mol |
| Exact Mass | 428.07 |
| IUPAC Name | 2-[4-[[2-[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetyl]amino]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(NC(=O)COc2ccc(/C=C3\SC(=O)NC3=O)cc2)cc1 |
| InChI | InChI=1S/C20H16N2O7S/c23-17(21-13-3-7-15(8-4-13)29-11-18(24)25)10-28-14-5-1-12(2-6-14)9-16-19(26)22-20(27)30-16/h1-9H,10-11H2,(H,21,23)(H,24,25)(H,22,26,27)/b16-9- |
| InChIKey | ZTQZAKCWESENPH-SXGWCWSVSA-N |
| XLogP | 2.49 |
| TPSA | 131.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.42 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|