C16H10BrN3OS — CID 167483085
(2Z)-2-(1,3-benzothiazol-2-ylhydrazinylidene)-5-bromo-3H-inden-1-one (PubChem CID 167483085) has the molecular formula C16H10BrN3OS and a molecular weight of 372.25 g/mol. Its IUPAC name is (2Z)-2-(1,3-benzothiazol-2-ylhydrazinylidene)-5-bromo-3H-inden-1-one.
| Compound Name | (2Z)-2-(1,3-benzothiazol-2-ylhydrazinylidene)-5-bromo-3H-inden-1-one |
|---|---|
| PubChem CID | 167483085 |
| Molecular Formula | C16H10BrN3OS |
| Molecular Weight | 372.25 g/mol |
| Exact Mass | 370.97 |
| IUPAC Name | (2Z)-2-(1,3-benzothiazol-2-ylhydrazinylidene)-5-bromo-3H-inden-1-one |
| SMILES | O=C1/C(=N\Nc2nc3ccccc3s2)Cc2cc(Br)ccc21 |
| InChI | InChI=1S/C16H10BrN3OS/c17-10-5-6-11-9(7-10)8-13(15(11)21)19-20-16-18-12-3-1-2-4-14(12)22-16/h1-7H,8H2,(H,18,20)/b19-13- |
| InChIKey | VVWFQEYYNIUQPH-UYRXBGFRSA-N |
| XLogP | 4.27 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.25 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|