C22H18N4O3S2 — CID 87464146
6-[(8E)-8-(1,3-benzothiazol-2-ylhydrazinylidene)-6,7-dihydro-5H-naphthalen-2-yl]pyridine-2-sulfonic acid (PubChem CID 87464146) has the molecular formula C22H18N4O3S2 and a molecular weight of 450.55 g/mol. Its IUPAC name is 6-[(8E)-8-(1,3-benzothiazol-2-ylhydrazinylidene)-6,7-dihydro-5H-naphthalen-2-yl]pyridine-2-sulfonic acid.
| Compound Name | 6-[(8E)-8-(1,3-benzothiazol-2-ylhydrazinylidene)-6,7-dihydro-5H-naphthalen-2-yl]pyridine-2-sulfonic acid |
|---|---|
| PubChem CID | 87464146 |
| Molecular Formula | C22H18N4O3S2 |
| Molecular Weight | 450.55 g/mol |
| Exact Mass | 450.08 |
| IUPAC Name | 6-[(8E)-8-(1,3-benzothiazol-2-ylhydrazinylidene)-6,7-dihydro-5H-naphthalen-2-yl]pyridine-2-sulfonic acid |
| SMILES | O=S(=O)(O)c1cccc(-c2ccc3c(c2)/C(=N/Nc2nc4ccccc4s2)CCC3)n1 |
| InChI | InChI=1S/C22H18N4O3S2/c27-31(28,29)21-10-4-7-17(23-21)15-12-11-14-5-3-8-18(16(14)13-15)25-26-22-24-19-6-1-2-9-20(19)30-22/h1-2,4,6-7,9-13H,3,5,8H2,(H,24,26)(H,27,28,29)/b25-18+ |
| InChIKey | PUVXRATVLSLHSI-XIEYBQDHSA-N |
| XLogP | 4.76 |
| TPSA | 104.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.55 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|