C23H21N5O2S2 — CID 146517921
2-[(5E)-5-(1,3-benzothiazol-2-ylhydrazinylidene)-6,7,8,9-tetrahydrobenzo[7]annulen-3-yl]-5-(methylamino)-1,3-thiazole-4-carboxylic acid (PubChem CID 146517921) has the molecular formula C23H21N5O2S2 and a molecular weight of 463.59 g/mol. Its IUPAC name is 2-[(5E)-5-(1,3-benzothiazol-2-ylhydrazinylidene)-6,7,8,9-tetrahydrobenzo[7]annulen-3-yl]-5-(methylamino)-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[(5E)-5-(1,3-benzothiazol-2-ylhydrazinylidene)-6,7,8,9-tetrahydrobenzo[7]annulen-3-yl]-5-(methylamino)-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 146517921 |
| Molecular Formula | C23H21N5O2S2 |
| Molecular Weight | 463.59 g/mol |
| Exact Mass | 463.11 |
| IUPAC Name | 2-[(5E)-5-(1,3-benzothiazol-2-ylhydrazinylidene)-6,7,8,9-tetrahydrobenzo[7]annulen-3-yl]-5-(methylamino)-1,3-thiazole-4-carboxylic acid |
| SMILES | CNc1sc(-c2ccc3c(c2)/C(=N/Nc2nc4ccccc4s2)CCCC3)nc1C(=O)O |
| InChI | InChI=1S/C23H21N5O2S2/c1-24-21-19(22(29)30)26-20(32-21)14-11-10-13-6-2-3-7-16(15(13)12-14)27-28-23-25-17-8-4-5-9-18(17)31-23/h4-5,8-12,24H,2-3,6-7H2,1H3,(H,25,28)(H,29,30)/b27-16+ |
| InChIKey | ISQNODVAMNPHJP-JVWAILMASA-N |
| XLogP | 5.70 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.59 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|