C31H30N4O2S2 — CID 71304788
2-[8-[2-(1,3-benzothiazol-2-yl)hydrazinyl]-5,6,7,8-tetrahydronaphthalen-2-yl]-5-(4-phenylbutyl)-1,3-thiazole-4-carboxylic acid (PubChem CID 71304788) has the molecular formula C31H30N4O2S2 and a molecular weight of 554.74 g/mol. Its IUPAC name is 2-[8-[2-(1,3-benzothiazol-2-yl)hydrazinyl]-5,6,7,8-tetrahydronaphthalen-2-yl]-5-(4-phenylbutyl)-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[8-[2-(1,3-benzothiazol-2-yl)hydrazinyl]-5,6,7,8-tetrahydronaphthalen-2-yl]-5-(4-phenylbutyl)-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 71304788 |
| Molecular Formula | C31H30N4O2S2 |
| Molecular Weight | 554.74 g/mol |
| Exact Mass | 554.18 |
| IUPAC Name | 2-[8-[2-(1,3-benzothiazol-2-yl)hydrazinyl]-5,6,7,8-tetrahydronaphthalen-2-yl]-5-(4-phenylbutyl)-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(O)c1nc(-c2ccc3c(c2)C(NNc2nc4ccccc4s2)CCC3)sc1CCCCc1ccccc1 |
| InChI | InChI=1S/C31H30N4O2S2/c36-30(37)28-27(16-6-4-11-20-9-2-1-3-10-20)38-29(33-28)22-18-17-21-12-8-14-24(23(21)19-22)34-35-31-32-25-13-5-7-15-26(25)39-31/h1-3,5,7,9-10,13,15,17-19,24,34H,4,6,8,11-12,14,16H2,(H,32,35)(H,36,37) |
| InChIKey | AYXKFPQKLRNEDS-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.74 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|