C31H28N4O3S2 — CID 131971855
7-[4-acetyl-5-(3-phenoxypropyl)-1,3-thiazol-2-yl]-N-(1,3-benzothiazol-2-yl)-3,4-dihydro-2H-quinoline-1-carboxamide (PubChem CID 131971855) has the molecular formula C31H28N4O3S2 and a molecular weight of 568.72 g/mol. Its IUPAC name is 7-[4-acetyl-5-(3-phenoxypropyl)-1,3-thiazol-2-yl]-N-(1,3-benzothiazol-2-yl)-3,4-dihydro-2H-quinoline-1-carboxamide.
| Compound Name | 7-[4-acetyl-5-(3-phenoxypropyl)-1,3-thiazol-2-yl]-N-(1,3-benzothiazol-2-yl)-3,4-dihydro-2H-quinoline-1-carboxamide |
|---|---|
| PubChem CID | 131971855 |
| Molecular Formula | C31H28N4O3S2 |
| Molecular Weight | 568.72 g/mol |
| Exact Mass | 568.16 |
| IUPAC Name | 7-[4-acetyl-5-(3-phenoxypropyl)-1,3-thiazol-2-yl]-N-(1,3-benzothiazol-2-yl)-3,4-dihydro-2H-quinoline-1-carboxamide |
| SMILES | CC(=O)c1nc(-c2ccc3c(c2)N(C(=O)Nc2nc4ccccc4s2)CCC3)sc1CCCOc1ccccc1 |
| InChI | InChI=1S/C31H28N4O3S2/c1-20(36)28-27(14-8-18-38-23-10-3-2-4-11-23)39-29(33-28)22-16-15-21-9-7-17-35(25(21)19-22)31(37)34-30-32-24-12-5-6-13-26(24)40-30/h2-6,10-13,15-16,19H,7-9,14,17-18H2,1H3,(H,32,34,37) |
| InChIKey | XZXIRHDOKVAUDW-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.72 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|