C31H24N4O3S2 — CID 91252518
N-(1,3-benzothiazol-2-yl)-7-(10-methyl-8,10-dioxo-10λ6-thia-6-azatricyclo[9.3.1.02,7]pentadeca-1(15),2(7),3,5,9,11,13-heptaen-5-yl)-3,4-dihydro-2H-quinoline-1-carboxamide (PubChem CID 91252518) has the molecular formula C31H24N4O3S2 and a molecular weight of 564.69 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-7-(10-methyl-8,10-dioxo-10λ6-thia-6-azatricyclo[9.3.1.02,7]pentadeca-1(15),2(7),3,5,9,11,13-heptaen-5-yl)-3,4-dihydro-2H-quinoline-1-carboxamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-7-(10-methyl-8,10-dioxo-10λ6-thia-6-azatricyclo[9.3.1.02,7]pentadeca-1(15),2(7),3,5,9,11,13-heptaen-5-yl)-3,4-dihydro-2H-quinoline-1-carboxamide |
|---|---|
| PubChem CID | 91252518 |
| Molecular Formula | C31H24N4O3S2 |
| Molecular Weight | 564.69 g/mol |
| Exact Mass | 564.13 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-7-(10-methyl-8,10-dioxo-10λ6-thia-6-azatricyclo[9.3.1.02,7]pentadeca-1(15),2(7),3,5,9,11,13-heptaen-5-yl)-3,4-dihydro-2H-quinoline-1-carboxamide |
| SMILES | CS1(=O)=CC(=O)c2nc(-c3ccc4c(c3)N(C(=O)Nc3nc5ccccc5s3)CCC4)ccc2-c2cccc1c2 |
| InChI | InChI=1S/C31H24N4O3S2/c1-40(38)18-27(36)29-23(20-6-4-8-22(40)16-20)13-14-24(32-29)21-12-11-19-7-5-15-35(26(19)17-21)31(37)34-30-33-25-9-2-3-10-28(25)39-30/h2-4,6,8-14,16-18H,5,7,15H2,1H3,(H,33,34,37) |
| InChIKey | MCNDXOAKYLNIFT-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.69 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|