C34H34N6O4S — CID 46841608
6-[1-(1,3-benzothiazol-2-ylcarbamoyl)-3,4-dihydro-2H-quinolin-7-yl]-3-[2-[[4-(dimethylamino)phenyl]methylamino]ethoxy]pyridine-2-carboxylic acid (PubChem CID 46841608) has the molecular formula C34H34N6O4S and a molecular weight of 622.75 g/mol. Its IUPAC name is 6-[1-(1,3-benzothiazol-2-ylcarbamoyl)-3,4-dihydro-2H-quinolin-7-yl]-3-[2-[[4-(dimethylamino)phenyl]methylamino]ethoxy]pyridine-2-carboxylic acid.
| Compound Name | 6-[1-(1,3-benzothiazol-2-ylcarbamoyl)-3,4-dihydro-2H-quinolin-7-yl]-3-[2-[[4-(dimethylamino)phenyl]methylamino]ethoxy]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 46841608 |
| Molecular Formula | C34H34N6O4S |
| Molecular Weight | 622.75 g/mol |
| Exact Mass | 622.24 |
| IUPAC Name | 6-[1-(1,3-benzothiazol-2-ylcarbamoyl)-3,4-dihydro-2H-quinolin-7-yl]-3-[2-[[4-(dimethylamino)phenyl]methylamino]ethoxy]pyridine-2-carboxylic acid |
| SMILES | CN(C)c1ccc(CNCCOc2ccc(-c3ccc4c(c3)N(C(=O)Nc3nc5ccccc5s3)CCC4)nc2C(=O)O)cc1 |
| InChI | InChI=1S/C34H34N6O4S/c1-39(2)25-13-9-22(10-14-25)21-35-17-19-44-29-16-15-26(36-31(29)32(41)42)24-12-11-23-6-5-18-40(28(23)20-24)34(43)38-33-37-27-7-3-4-8-30(27)45-33/h3-4,7-16,20,35H,5-6,17-19,21H2,1-2H3,(H,41,42)(H,37,38,43) |
| InChIKey | IGRYCCZPZKOHII-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 119.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.75 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|