C24H20N4O2S — CID 78167295
6-[5-(1,3-benzothiazol-2-ylhydrazinylidene)-6,7,8,9-tetrahydrobenzo[7]annulen-3-yl]pyridine-2-carboxylic acid (PubChem CID 78167295) has the molecular formula C24H20N4O2S and a molecular weight of 428.52 g/mol. Its IUPAC name is 6-[5-(1,3-benzothiazol-2-ylhydrazinylidene)-6,7,8,9-tetrahydrobenzo[7]annulen-3-yl]pyridine-2-carboxylic acid.
| Compound Name | 6-[5-(1,3-benzothiazol-2-ylhydrazinylidene)-6,7,8,9-tetrahydrobenzo[7]annulen-3-yl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 78167295 |
| Molecular Formula | C24H20N4O2S |
| Molecular Weight | 428.52 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | 6-[5-(1,3-benzothiazol-2-ylhydrazinylidene)-6,7,8,9-tetrahydrobenzo[7]annulen-3-yl]pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1cccc(-c2ccc3c(c2)C(=NNc2nc4ccccc4s2)CCCC3)n1 |
| InChI | InChI=1S/C24H20N4O2S/c29-23(30)21-10-5-9-18(25-21)16-13-12-15-6-1-2-7-19(17(15)14-16)27-28-24-26-20-8-3-4-11-22(20)31-24/h3-5,8-14H,1-2,6-7H2,(H,26,28)(H,29,30) |
| InChIKey | OFCDJHMBCOAWLY-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 87.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.52 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|