C19H14N4O2S2 — CID 78168402
6-[5-[N-(1,3-benzothiazol-2-ylamino)-C-methylcarbonimidoyl]thiophen-2-yl]pyridine-2-carboxylic acid (PubChem CID 78168402) has the molecular formula C19H14N4O2S2 and a molecular weight of 394.48 g/mol. Its IUPAC name is 6-[5-[N-(1,3-benzothiazol-2-ylamino)-C-methylcarbonimidoyl]thiophen-2-yl]pyridine-2-carboxylic acid.
| Compound Name | 6-[5-[N-(1,3-benzothiazol-2-ylamino)-C-methylcarbonimidoyl]thiophen-2-yl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 78168402 |
| Molecular Formula | C19H14N4O2S2 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | 6-[5-[N-(1,3-benzothiazol-2-ylamino)-C-methylcarbonimidoyl]thiophen-2-yl]pyridine-2-carboxylic acid |
| SMILES | CC(=NNc1nc2ccccc2s1)c1ccc(-c2cccc(C(=O)O)n2)s1 |
| InChI | InChI=1S/C19H14N4O2S2/c1-11(22-23-19-21-13-5-2-3-8-16(13)27-19)15-9-10-17(26-15)12-6-4-7-14(20-12)18(24)25/h2-10H,1H3,(H,21,23)(H,24,25) |
| InChIKey | SRWFHBGNGFRWNX-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 87.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|