C16H13F2N3OS — CID 9017037
N-[(Z)-1-[3-(difluoromethoxy)phenyl]ethylideneamino]-1,3-benzothiazol-2-amine (PubChem CID 9017037) has the molecular formula C16H13F2N3OS and a molecular weight of 333.36 g/mol. Its IUPAC name is N-[(Z)-1-[3-(difluoromethoxy)phenyl]ethylideneamino]-1,3-benzothiazol-2-amine.
| Compound Name | N-[(Z)-1-[3-(difluoromethoxy)phenyl]ethylideneamino]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 9017037 |
| Molecular Formula | C16H13F2N3OS |
| Molecular Weight | 333.36 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | N-[(Z)-1-[3-(difluoromethoxy)phenyl]ethylideneamino]-1,3-benzothiazol-2-amine |
| SMILES | C/C(=N/Nc1nc2ccccc2s1)c1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C16H13F2N3OS/c1-10(11-5-4-6-12(9-11)22-15(17)18)20-21-16-19-13-7-2-3-8-14(13)23-16/h2-9,15H,1H3,(H,19,21)/b20-10- |
| InChIKey | JAFYBHIHTWBPFS-JMIUGGIZSA-N |
| XLogP | 4.73 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.36 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|