C16H14F4N2O2 — CID 121005385
N-[(E)-1-[3,5-bis(difluoromethoxy)phenyl]ethylideneamino]aniline (PubChem CID 121005385) has the molecular formula C16H14F4N2O2 and a molecular weight of 342.29 g/mol. Its IUPAC name is N-[(E)-1-[3,5-bis(difluoromethoxy)phenyl]ethylideneamino]aniline.
| Compound Name | N-[(E)-1-[3,5-bis(difluoromethoxy)phenyl]ethylideneamino]aniline |
|---|---|
| PubChem CID | 121005385 |
| Molecular Formula | C16H14F4N2O2 |
| Molecular Weight | 342.29 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | N-[(E)-1-[3,5-bis(difluoromethoxy)phenyl]ethylideneamino]aniline |
| SMILES | C/C(=N\Nc1ccccc1)c1cc(OC(F)F)cc(OC(F)F)c1 |
| InChI | InChI=1S/C16H14F4N2O2/c1-10(21-22-12-5-3-2-4-6-12)11-7-13(23-15(17)18)9-14(8-11)24-16(19)20/h2-9,15-16,22H,1H3/b21-10+ |
| InChIKey | ICBGTZGPYKHKQF-UFFVCSGVSA-N |
| XLogP | 4.73 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.29 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|