C12H16F2N2O3 — CID 162544823
3-[[3-(difluoromethoxy)phenyl]hydrazinylidene]pentane-2,4-diol (PubChem CID 162544823) has the molecular formula C12H16F2N2O3 and a molecular weight of 274.27 g/mol. Its IUPAC name is 3-[[3-(difluoromethoxy)phenyl]hydrazinylidene]pentane-2,4-diol.
| Compound Name | 3-[[3-(difluoromethoxy)phenyl]hydrazinylidene]pentane-2,4-diol |
|---|---|
| PubChem CID | 162544823 |
| Molecular Formula | C12H16F2N2O3 |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 3-[[3-(difluoromethoxy)phenyl]hydrazinylidene]pentane-2,4-diol |
| SMILES | CC(O)C(=NNc1cccc(OC(F)F)c1)C(C)O |
| InChI | InChI=1S/C12H16F2N2O3/c1-7(17)11(8(2)18)16-15-9-4-3-5-10(6-9)19-12(13)14/h3-8,12,15,17-18H,1-2H3 |
| InChIKey | ASGYREIIQSDCLN-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 74.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|