C18H20F2N2O3 — CID 51952913
3-[3-(difluoromethoxy)phenyl]-1-[(1R)-1-(2-methoxyphenyl)ethyl]-1-methylurea (PubChem CID 51952913) has the molecular formula C18H20F2N2O3 and a molecular weight of 350.37 g/mol. Its IUPAC name is 3-[3-(difluoromethoxy)phenyl]-1-[(1R)-1-(2-methoxyphenyl)ethyl]-1-methylurea.
| Compound Name | 3-[3-(difluoromethoxy)phenyl]-1-[(1R)-1-(2-methoxyphenyl)ethyl]-1-methylurea |
|---|---|
| PubChem CID | 51952913 |
| Molecular Formula | C18H20F2N2O3 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 3-[3-(difluoromethoxy)phenyl]-1-[(1R)-1-(2-methoxyphenyl)ethyl]-1-methylurea |
| SMILES | COc1ccccc1[C@@H](C)N(C)C(=O)Nc1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C18H20F2N2O3/c1-12(15-9-4-5-10-16(15)24-3)22(2)18(23)21-13-7-6-8-14(11-13)25-17(19)20/h4-12,17H,1-3H3,(H,21,23)/t12-/m1/s1 |
| InChIKey | USYMGGZYHJHSKP-GFCCVEGCSA-N |
| XLogP | 4.52 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |