C25H24N2O2 — CID 112825452
1-[1-(4-methoxyphenyl)ethyl]-1-methyl-3-[3-(2-phenylethynyl)phenyl]urea (PubChem CID 112825452) has the molecular formula C25H24N2O2 and a molecular weight of 384.48 g/mol. Its IUPAC name is 1-[1-(4-methoxyphenyl)ethyl]-1-methyl-3-[3-(2-phenylethynyl)phenyl]urea.
| Compound Name | 1-[1-(4-methoxyphenyl)ethyl]-1-methyl-3-[3-(2-phenylethynyl)phenyl]urea |
|---|---|
| PubChem CID | 112825452 |
| Molecular Formula | C25H24N2O2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 1-[1-(4-methoxyphenyl)ethyl]-1-methyl-3-[3-(2-phenylethynyl)phenyl]urea |
| SMILES | COc1ccc(C(C)N(C)C(=O)Nc2cccc(C#Cc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C25H24N2O2/c1-19(22-14-16-24(29-3)17-15-22)27(2)25(28)26-23-11-7-10-21(18-23)13-12-20-8-5-4-6-9-20/h4-11,14-19H,1-3H3,(H,26,28) |
| InChIKey | BDLUHUXWRRWNOV-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|