C20H20N4OS — CID 167483103
(2Z)-2-(1,3-benzothiazol-2-ylhydrazinylidene)-6-(diethylamino)-3H-inden-1-one (PubChem CID 167483103) has the molecular formula C20H20N4OS and a molecular weight of 364.47 g/mol. Its IUPAC name is (2Z)-2-(1,3-benzothiazol-2-ylhydrazinylidene)-6-(diethylamino)-3H-inden-1-one.
| Compound Name | (2Z)-2-(1,3-benzothiazol-2-ylhydrazinylidene)-6-(diethylamino)-3H-inden-1-one |
|---|---|
| PubChem CID | 167483103 |
| Molecular Formula | C20H20N4OS |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | (2Z)-2-(1,3-benzothiazol-2-ylhydrazinylidene)-6-(diethylamino)-3H-inden-1-one |
| SMILES | CCN(CC)c1ccc2c(c1)C(=O)/C(=N\Nc1nc3ccccc3s1)C2 |
| InChI | InChI=1S/C20H20N4OS/c1-3-24(4-2)14-10-9-13-11-17(19(25)15(13)12-14)22-23-20-21-16-7-5-6-8-18(16)26-20/h5-10,12H,3-4,11H2,1-2H3,(H,21,23)/b22-17- |
| InChIKey | PBUNBZTUYHTMIW-XLNRJJMWSA-N |
| XLogP | 4.35 |
| TPSA | 57.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|