C17H12N2OS — CID 76554065
2-[(1,3-benzothiazol-2-ylamino)methylidene]-3H-inden-1-one (PubChem CID 76554065) has the molecular formula C17H12N2OS and a molecular weight of 292.36 g/mol. Its IUPAC name is 2-[(1,3-benzothiazol-2-ylamino)methylidene]-3H-inden-1-one.
| Compound Name | 2-[(1,3-benzothiazol-2-ylamino)methylidene]-3H-inden-1-one |
|---|---|
| PubChem CID | 76554065 |
| Molecular Formula | C17H12N2OS |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 2-[(1,3-benzothiazol-2-ylamino)methylidene]-3H-inden-1-one |
| SMILES | O=C1C(=CNc2nc3ccccc3s2)Cc2ccccc21 |
| InChI | InChI=1S/C17H12N2OS/c20-16-12(9-11-5-1-2-6-13(11)16)10-18-17-19-14-7-3-4-8-15(14)21-17/h1-8,10H,9H2,(H,18,19) |
| InChIKey | PYLFGNUZCRIFLI-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|