C16H15N3OS — CID 3270340
4-[N-(1,3-benzothiazol-2-ylamino)-C-ethylcarbonimidoyl]phenol (PubChem CID 3270340) has the molecular formula C16H15N3OS and a molecular weight of 297.38 g/mol. Its IUPAC name is 4-[N-(1,3-benzothiazol-2-ylamino)-C-ethylcarbonimidoyl]phenol.
| Compound Name | 4-[N-(1,3-benzothiazol-2-ylamino)-C-ethylcarbonimidoyl]phenol |
|---|---|
| PubChem CID | 3270340 |
| Molecular Formula | C16H15N3OS |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 4-[N-(1,3-benzothiazol-2-ylamino)-C-ethylcarbonimidoyl]phenol |
| SMILES | CCC(=NNc1nc2ccccc2s1)c1ccc(O)cc1 |
| InChI | InChI=1S/C16H15N3OS/c1-2-13(11-7-9-12(20)10-8-11)18-19-16-17-14-5-3-4-6-15(14)21-16/h3-10,20H,2H2,1H3,(H,17,19) |
| InChIKey | NYMRVCBDPMLRPF-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|