C24H17N3O2S — CID 135472842
2-[(Z)-N-(1,3-benzothiazol-2-ylamino)-C-(4-methylphenyl)carbonimidoyl]-3-hydroxyinden-1-one (PubChem CID 135472842) has the molecular formula C24H17N3O2S and a molecular weight of 411.49 g/mol. Its IUPAC name is 2-[(Z)-N-(1,3-benzothiazol-2-ylamino)-C-(4-methylphenyl)carbonimidoyl]-3-hydroxyinden-1-one.
| Compound Name | 2-[(Z)-N-(1,3-benzothiazol-2-ylamino)-C-(4-methylphenyl)carbonimidoyl]-3-hydroxyinden-1-one |
|---|---|
| PubChem CID | 135472842 |
| Molecular Formula | C24H17N3O2S |
| Molecular Weight | 411.49 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | 2-[(Z)-N-(1,3-benzothiazol-2-ylamino)-C-(4-methylphenyl)carbonimidoyl]-3-hydroxyinden-1-one |
| SMILES | Cc1ccc(/C(=N/Nc2nc3ccccc3s2)C2=C(O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C24H17N3O2S/c1-14-10-12-15(13-11-14)21(20-22(28)16-6-2-3-7-17(16)23(20)29)26-27-24-25-18-8-4-5-9-19(18)30-24/h2-13,28H,1H3,(H,25,27)/b26-21- |
| InChIKey | GCCMDXKKILJDQV-QLYXXIJNSA-N |
| XLogP | 5.59 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.49 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_enamin(30)', 'substructure': 'N/A'}, {'alert_name': 'keto_keto_beta_C(7)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|