C18H18N4S — CID 138517648
N'-(1,3-benzothiazol-2-ylamino)-N-[(2-ethylphenyl)methylidene]ethanimidamide (PubChem CID 138517648) has the molecular formula C18H18N4S and a molecular weight of 322.44 g/mol. Its IUPAC name is N'-(1,3-benzothiazol-2-ylamino)-N-[(2-ethylphenyl)methylidene]ethanimidamide.
| Compound Name | N'-(1,3-benzothiazol-2-ylamino)-N-[(2-ethylphenyl)methylidene]ethanimidamide |
|---|---|
| PubChem CID | 138517648 |
| Molecular Formula | C18H18N4S |
| Molecular Weight | 322.44 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | N'-(1,3-benzothiazol-2-ylamino)-N-[(2-ethylphenyl)methylidene]ethanimidamide |
| SMILES | CCc1ccccc1/C=N/C(C)=N\Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C18H18N4S/c1-3-14-8-4-5-9-15(14)12-19-13(2)21-22-18-20-16-10-6-7-11-17(16)23-18/h4-12H,3H2,1-2H3,(H,20,22)/b19-12+,21-13- |
| InChIKey | WBMKILSCYPOZQM-VVPWPQJISA-N |
| XLogP | 4.72 |
| TPSA | 49.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.44 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|