C15H18O3 — CID 55068543
3-tert-butyl-5,7-dimethyl-1-benzofuran-2-carboxylic acid (PubChem CID 55068543) has the molecular formula C15H18O3 and a molecular weight of 246.31 g/mol. Its IUPAC name is 3-tert-butyl-5,7-dimethyl-1-benzofuran-2-carboxylic acid.
| Compound Name | 3-tert-butyl-5,7-dimethyl-1-benzofuran-2-carboxylic acid |
|---|---|
| PubChem CID | 55068543 |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | 3-tert-butyl-5,7-dimethyl-1-benzofuran-2-carboxylic acid |
| SMILES | Cc1cc(C)c2oc(C(=O)O)c(C(C)(C)C)c2c1 |
| InChI | InChI=1S/C15H18O3/c1-8-6-9(2)12-10(7-8)11(15(3,4)5)13(18-12)14(16)17/h6-7H,1-5H3,(H,16,17) |
| InChIKey | UNHDHOKMLBOQFT-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |