C16H10Br2O2 — CID 162642889
5,7-dibromo-2-(4-methylphenyl)chromen-4-one (PubChem CID 162642889) has the molecular formula C16H10Br2O2 and a molecular weight of 394.06 g/mol. Its IUPAC name is 5,7-dibromo-2-(4-methylphenyl)chromen-4-one.
| Compound Name | 5,7-dibromo-2-(4-methylphenyl)chromen-4-one |
|---|---|
| PubChem CID | 162642889 |
| Molecular Formula | C16H10Br2O2 |
| Molecular Weight | 394.06 g/mol |
| Exact Mass | 391.90 |
| IUPAC Name | 5,7-dibromo-2-(4-methylphenyl)chromen-4-one |
| SMILES | Cc1ccc(-c2cc(=O)c3c(Br)cc(Br)cc3o2)cc1 |
| InChI | InChI=1S/C16H10Br2O2/c1-9-2-4-10(5-3-9)14-8-13(19)16-12(18)6-11(17)7-15(16)20-14/h2-8H,1H3 |
| InChIKey | SZWURQWCRZZAFU-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.06 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |