C20H19ClO5 — CID 71739541
6-chloro-5,7-dimethyl-2-(3,4,5-trimethoxyphenyl)chromen-4-one (PubChem CID 71739541) has the molecular formula C20H19ClO5 and a molecular weight of 374.82 g/mol. Its IUPAC name is 6-chloro-5,7-dimethyl-2-(3,4,5-trimethoxyphenyl)chromen-4-one.
| Compound Name | 6-chloro-5,7-dimethyl-2-(3,4,5-trimethoxyphenyl)chromen-4-one |
|---|---|
| PubChem CID | 71739541 |
| Molecular Formula | C20H19ClO5 |
| Molecular Weight | 374.82 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | 6-chloro-5,7-dimethyl-2-(3,4,5-trimethoxyphenyl)chromen-4-one |
| SMILES | COc1cc(-c2cc(=O)c3c(C)c(Cl)c(C)cc3o2)cc(OC)c1OC |
| InChI | InChI=1S/C20H19ClO5/c1-10-6-15-18(11(2)19(10)21)13(22)9-14(26-15)12-7-16(23-3)20(25-5)17(8-12)24-4/h6-9H,1-5H3 |
| InChIKey | BOUKBOMKKITVQJ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.82 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |