C20H18O7 — CID 71413141
[4-oxo-2-(3,4,5-trimethoxyphenyl)chromen-5-yl] acetate (PubChem CID 71413141) has the molecular formula C20H18O7 and a molecular weight of 370.36 g/mol. Its IUPAC name is [4-oxo-2-(3,4,5-trimethoxyphenyl)chromen-5-yl] acetate.
| Compound Name | [4-oxo-2-(3,4,5-trimethoxyphenyl)chromen-5-yl] acetate |
|---|---|
| PubChem CID | 71413141 |
| Molecular Formula | C20H18O7 |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | [4-oxo-2-(3,4,5-trimethoxyphenyl)chromen-5-yl] acetate |
| SMILES | COc1cc(-c2cc(=O)c3c(OC(C)=O)cccc3o2)cc(OC)c1OC |
| InChI | InChI=1S/C20H18O7/c1-11(21)26-14-6-5-7-15-19(14)13(22)10-16(27-15)12-8-17(23-2)20(25-4)18(9-12)24-3/h5-10H,1-4H3 |
| InChIKey | MQDIHNOFBYQUNI-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 84.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|