C30H18O10 — CID 171431176
8-[2,3-dihydroxy-6-(4-oxochromen-2-yl)phenyl]-2-(3,4-dihydroxyphenyl)-5,7-dihydroxychromen-4-one (PubChem CID 171431176) has the molecular formula C30H18O10 and a molecular weight of 538.46 g/mol. Its IUPAC name is 8-[2,3-dihydroxy-6-(4-oxochromen-2-yl)phenyl]-2-(3,4-dihydroxyphenyl)-5,7-dihydroxychromen-4-one.
| Compound Name | 8-[2,3-dihydroxy-6-(4-oxochromen-2-yl)phenyl]-2-(3,4-dihydroxyphenyl)-5,7-dihydroxychromen-4-one |
|---|---|
| PubChem CID | 171431176 |
| Molecular Formula | C30H18O10 |
| Molecular Weight | 538.46 g/mol |
| Exact Mass | 538.09 |
| IUPAC Name | 8-[2,3-dihydroxy-6-(4-oxochromen-2-yl)phenyl]-2-(3,4-dihydroxyphenyl)-5,7-dihydroxychromen-4-one |
| SMILES | O=c1cc(-c2ccc(O)c(O)c2-c2c(O)cc(O)c3c(=O)cc(-c4ccc(O)c(O)c4)oc23)oc2ccccc12 |
| InChI | InChI=1S/C30H18O10/c31-16-7-5-13(9-19(16)34)24-12-22(37)27-20(35)10-21(36)28(30(27)40-24)26-15(6-8-17(32)29(26)38)25-11-18(33)14-3-1-2-4-23(14)39-25/h1-12,31-32,34-36,38H |
| InChIKey | MGGZOUFCSWVZOL-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 181.80 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.46 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|