C19H12O5 — CID 135053109
2-(3,4-dihydroxyphenyl)-5-hydroxybenzo[g]chromen-4-one (PubChem CID 135053109) has the molecular formula C19H12O5 and a molecular weight of 320.30 g/mol. Its IUPAC name is 2-(3,4-dihydroxyphenyl)-5-hydroxybenzo[g]chromen-4-one.
| Compound Name | 2-(3,4-dihydroxyphenyl)-5-hydroxybenzo[g]chromen-4-one |
|---|---|
| PubChem CID | 135053109 |
| Molecular Formula | C19H12O5 |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-5-hydroxybenzo[g]chromen-4-one |
| SMILES | O=c1cc(-c2ccc(O)c(O)c2)oc2cc3ccccc3c(O)c12 |
| InChI | InChI=1S/C19H12O5/c20-13-6-5-11(7-14(13)21)16-9-15(22)18-17(24-16)8-10-3-1-2-4-12(10)19(18)23/h1-9,20-21,23H |
| InChIKey | PTVRHXRPVBTIRQ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|