C19H15NO7 — CID 162864069
(5R)-5-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxochromen-6-yl]pyrrolidin-2-one (PubChem CID 162864069) has the molecular formula C19H15NO7 and a molecular weight of 369.33 g/mol. Its IUPAC name is (5R)-5-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxochromen-6-yl]pyrrolidin-2-one.
| Compound Name | (5R)-5-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxochromen-6-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 162864069 |
| Molecular Formula | C19H15NO7 |
| Molecular Weight | 369.33 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | (5R)-5-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxochromen-6-yl]pyrrolidin-2-one |
| SMILES | O=C1CC[C@H](c2c(O)cc3oc(-c4ccc(O)c(O)c4)cc(=O)c3c2O)N1 |
| InChI | InChI=1S/C19H15NO7/c21-10-3-1-8(5-11(10)22)14-6-13(24)18-15(27-14)7-12(23)17(19(18)26)9-2-4-16(25)20-9/h1,3,5-7,9,21-23,26H,2,4H2,(H,20,25)/t9-/m1/s1 |
| InChIKey | KVJIPWCWUFSXCX-SECBINFHSA-N |
| XLogP | 2.23 |
| TPSA | 140.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.33 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|