C21H21NO4 — CID 57343252
5,7-dihydroxy-6-(1-methylpiperidin-2-yl)-2-phenylchromen-4-one (PubChem CID 57343252) has the molecular formula C21H21NO4 and a molecular weight of 351.40 g/mol. Its IUPAC name is 5,7-dihydroxy-6-(1-methylpiperidin-2-yl)-2-phenylchromen-4-one.
| Compound Name | 5,7-dihydroxy-6-(1-methylpiperidin-2-yl)-2-phenylchromen-4-one |
|---|---|
| PubChem CID | 57343252 |
| Molecular Formula | C21H21NO4 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | 5,7-dihydroxy-6-(1-methylpiperidin-2-yl)-2-phenylchromen-4-one |
| SMILES | CN1CCCCC1c1c(O)cc2oc(-c3ccccc3)cc(=O)c2c1O |
| InChI | InChI=1S/C21H21NO4/c1-22-10-6-5-9-14(22)19-15(23)12-18-20(21(19)25)16(24)11-17(26-18)13-7-3-2-4-8-13/h2-4,7-8,11-12,14,23,25H,5-6,9-10H2,1H3 |
| InChIKey | RVDLLAUEPCPXGP-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|