C21H21NO5 — CID 162843770
5,7-dihydroxy-2-(4-hydroxyphenyl)-6-(1-methylpiperidin-2-yl)chromen-4-one (PubChem CID 162843770) has the molecular formula C21H21NO5 and a molecular weight of 367.40 g/mol. Its IUPAC name is 5,7-dihydroxy-2-(4-hydroxyphenyl)-6-(1-methylpiperidin-2-yl)chromen-4-one.
| Compound Name | 5,7-dihydroxy-2-(4-hydroxyphenyl)-6-(1-methylpiperidin-2-yl)chromen-4-one |
|---|---|
| PubChem CID | 162843770 |
| Molecular Formula | C21H21NO5 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 5,7-dihydroxy-2-(4-hydroxyphenyl)-6-(1-methylpiperidin-2-yl)chromen-4-one |
| SMILES | CN1CCCCC1c1c(O)cc2oc(-c3ccc(O)cc3)cc(=O)c2c1O |
| InChI | InChI=1S/C21H21NO5/c1-22-9-3-2-4-14(22)19-15(24)11-18-20(21(19)26)16(25)10-17(27-18)12-5-7-13(23)8-6-12/h5-8,10-11,14,23-24,26H,2-4,9H2,1H3 |
| InChIKey | NHVRPSTUXVJCGJ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 94.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|