C19H12O4S — CID 54769632
5,7-dihydroxy-2-phenyl-8-thiophen-3-ylchromen-4-one (PubChem CID 54769632) has the molecular formula C19H12O4S and a molecular weight of 336.37 g/mol. Its IUPAC name is 5,7-dihydroxy-2-phenyl-8-thiophen-3-ylchromen-4-one.
| Compound Name | 5,7-dihydroxy-2-phenyl-8-thiophen-3-ylchromen-4-one |
|---|---|
| PubChem CID | 54769632 |
| Molecular Formula | C19H12O4S |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | 5,7-dihydroxy-2-phenyl-8-thiophen-3-ylchromen-4-one |
| SMILES | O=c1cc(-c2ccccc2)oc2c(-c3ccsc3)c(O)cc(O)c12 |
| InChI | InChI=1S/C19H12O4S/c20-13-8-14(21)18-15(22)9-16(11-4-2-1-3-5-11)23-19(18)17(13)12-6-7-24-10-12/h1-10,20-21H |
| InChIKey | ZEZIXFVHGXCDIR-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |