About 5-hydroxy-7-morpholin-4-yl-2,8-diphenylchromen-4-one
5-hydroxy-7-morpholin-4-yl-2,8-diphenylchromen-4-one (PubChem CID 71457402) has the molecular formula C25H21NO4
and a molecular weight of 399.45 g/mol. Its IUPAC name is 5-hydroxy-7-morpholin-4-yl-2,8-diphenylchromen-4-one.
Molecular Properties
| Compound Name | 5-hydroxy-7-morpholin-4-yl-2,8-diphenylchromen-4-one |
| PubChem CID | 71457402 |
| Molecular Formula | C25H21NO4 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | 5-hydroxy-7-morpholin-4-yl-2,8-diphenylchromen-4-one |
| SMILES | O=c1cc(-c2ccccc2)oc2c(-c3ccccc3)c(N3CCOCC3)cc(O)c12 |
| InChI | InChI=1S/C25H21NO4/c27-20-15-19(26-11-13-29-14-12-26)23(18-9-5-2-6-10-18)25-24(20)21(28)16-22(30-25)17-7-3-1-4-8-17/h1-10,15-16,27H,11-14H2 |
| InChIKey | CXILKGKCFULRQK-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-hydroxy-7-morpholin-4-yl-2,8-diphenylchromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxy-7-morpholin-4-yl-2,8-diphenylchromen-4-one?
The IUPAC name of 5-hydroxy-7-morpholin-4-yl-2,8-diphenylchromen-4-one (CID 71457402) is 5-hydroxy-7-morpholin-4-yl-2,8-diphenylchromen-4-one.
What is the SMILES notation for 5-hydroxy-7-morpholin-4-yl-2,8-diphenylchromen-4-one?
The canonical SMILES for 5-hydroxy-7-morpholin-4-yl-2,8-diphenylchromen-4-one is O=c1cc(-c2ccccc2)oc2c(-c3ccccc3)c(N3CCOCC3)cc(O)c12.
What is the InChIKey of 5-hydroxy-7-morpholin-4-yl-2,8-diphenylchromen-4-one?
The InChIKey is CXILKGKCFULRQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H21NO4/c27-20-15-19(26-11-13-29-14-12-26)23(18-9-5-2-6-10-18)25-24(20)21(28)16-22(30-25)17-7-3-1-4-8-17/h1-10,15-16,27H,11-14H2.
What are the key properties of 5-hydroxy-7-morpholin-4-yl-2,8-diphenylchromen-4-one?
5-hydroxy-7-morpholin-4-yl-2,8-diphenylchromen-4-one has a molecular weight of 399.45 g/mol, XLogP of 4.67, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-7-morpholin-4-yl-2,8-diphenylchromen-4-one is sourced from PubChem (CID 71457402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).