About 8-cyclopentyloxy-5,7-dihydroxy-2-[4-(4-methylpiperazin-1-yl)phenyl]chromen-4-one
8-cyclopentyloxy-5,7-dihydroxy-2-[4-(4-methylpiperazin-1-yl)phenyl]chromen-4-one (PubChem CID 155560694) has the molecular formula C25H28N2O5
and a molecular weight of 436.51 g/mol. Its IUPAC name is 8-cyclopentyloxy-5,7-dihydroxy-2-[4-(4-methylpiperazin-1-yl)phenyl]chromen-4-one.
Molecular Properties
| Compound Name | 8-cyclopentyloxy-5,7-dihydroxy-2-[4-(4-methylpiperazin-1-yl)phenyl]chromen-4-one |
| PubChem CID | 155560694 |
| Molecular Formula | C25H28N2O5 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | 8-cyclopentyloxy-5,7-dihydroxy-2-[4-(4-methylpiperazin-1-yl)phenyl]chromen-4-one |
| SMILES | CN1CCN(c2ccc(-c3cc(=O)c4c(O)cc(O)c(OC5CCCC5)c4o3)cc2)CC1 |
| InChI | InChI=1S/C25H28N2O5/c1-26-10-12-27(13-11-26)17-8-6-16(7-9-17)22-15-20(29)23-19(28)14-21(30)24(25(23)32-22)31-18-4-2-3-5-18/h6-9,14-15,18,28,30H,2-5,10-13H2,1H3 |
| InChIKey | VOIWHQCNVKDEQQ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 86.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 8-cyclopentyloxy-5,7-dihydroxy-2-[4-(4-methylpiperazin-1-yl)phenyl]chromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-cyclopentyloxy-5,7-dihydroxy-2-[4-(4-methylpiperazin-1-yl)phenyl]chromen-4-one?
The IUPAC name of 8-cyclopentyloxy-5,7-dihydroxy-2-[4-(4-methylpiperazin-1-yl)phenyl]chromen-4-one (CID 155560694) is 8-cyclopentyloxy-5,7-dihydroxy-2-[4-(4-methylpiperazin-1-yl)phenyl]chromen-4-one.
What is the SMILES notation for 8-cyclopentyloxy-5,7-dihydroxy-2-[4-(4-methylpiperazin-1-yl)phenyl]chromen-4-one?
The canonical SMILES for 8-cyclopentyloxy-5,7-dihydroxy-2-[4-(4-methylpiperazin-1-yl)phenyl]chromen-4-one is CN1CCN(c2ccc(-c3cc(=O)c4c(O)cc(O)c(OC5CCCC5)c4o3)cc2)CC1.
What is the InChIKey of 8-cyclopentyloxy-5,7-dihydroxy-2-[4-(4-methylpiperazin-1-yl)phenyl]chromen-4-one?
The InChIKey is VOIWHQCNVKDEQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H28N2O5/c1-26-10-12-27(13-11-26)17-8-6-16(7-9-17)22-15-20(29)23-19(28)14-21(30)24(25(23)32-22)31-18-4-2-3-5-18/h6-9,14-15,18,28,30H,2-5,10-13H2,1H3.
What are the key properties of 8-cyclopentyloxy-5,7-dihydroxy-2-[4-(4-methylpiperazin-1-yl)phenyl]chromen-4-one?
8-cyclopentyloxy-5,7-dihydroxy-2-[4-(4-methylpiperazin-1-yl)phenyl]chromen-4-one has a molecular weight of 436.51 g/mol, XLogP of 3.94, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 8-cyclopentyloxy-5,7-dihydroxy-2-[4-(4-methylpiperazin-1-yl)phenyl]chromen-4-one is sourced from PubChem (CID 155560694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).