About 3-[2-(4-fluorophenyl)-5-hydroxy-4-oxo-7-phenylmethoxychromen-8-yl]oxypentane-2,4-dione
3-[2-(4-fluorophenyl)-5-hydroxy-4-oxo-7-phenylmethoxychromen-8-yl]oxypentane-2,4-dione (PubChem CID 172693463) has the molecular formula C27H21FO7
and a molecular weight of 476.46 g/mol. Its IUPAC name is 3-[2-(4-fluorophenyl)-5-hydroxy-4-oxo-7-phenylmethoxychromen-8-yl]oxypentane-2,4-dione.
Molecular Properties
| Compound Name | 3-[2-(4-fluorophenyl)-5-hydroxy-4-oxo-7-phenylmethoxychromen-8-yl]oxypentane-2,4-dione |
| PubChem CID | 172693463 |
| Molecular Formula | C27H21FO7 |
| Molecular Weight | 476.46 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | 3-[2-(4-fluorophenyl)-5-hydroxy-4-oxo-7-phenylmethoxychromen-8-yl]oxypentane-2,4-dione |
| SMILES | CC(=O)C(Oc1c(OCc2ccccc2)cc(O)c2c(=O)cc(-c3ccc(F)cc3)oc12)C(C)=O |
| InChI | InChI=1S/C27H21FO7/c1-15(29)25(16(2)30)35-26-23(33-14-17-6-4-3-5-7-17)13-21(32)24-20(31)12-22(34-27(24)26)18-8-10-19(28)11-9-18/h3-13,25,32H,14H2,1-2H3 |
| InChIKey | BZOFDIABYNPICO-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 476.46 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-(4-fluorophenyl)-5-hydroxy-4-oxo-7-phenylmethoxychromen-8-yl]oxypentane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(4-fluorophenyl)-5-hydroxy-4-oxo-7-phenylmethoxychromen-8-yl]oxypentane-2,4-dione?
The IUPAC name of 3-[2-(4-fluorophenyl)-5-hydroxy-4-oxo-7-phenylmethoxychromen-8-yl]oxypentane-2,4-dione (CID 172693463) is 3-[2-(4-fluorophenyl)-5-hydroxy-4-oxo-7-phenylmethoxychromen-8-yl]oxypentane-2,4-dione.
What is the SMILES notation for 3-[2-(4-fluorophenyl)-5-hydroxy-4-oxo-7-phenylmethoxychromen-8-yl]oxypentane-2,4-dione?
The canonical SMILES for 3-[2-(4-fluorophenyl)-5-hydroxy-4-oxo-7-phenylmethoxychromen-8-yl]oxypentane-2,4-dione is CC(=O)C(Oc1c(OCc2ccccc2)cc(O)c2c(=O)cc(-c3ccc(F)cc3)oc12)C(C)=O.
What is the InChIKey of 3-[2-(4-fluorophenyl)-5-hydroxy-4-oxo-7-phenylmethoxychromen-8-yl]oxypentane-2,4-dione?
The InChIKey is BZOFDIABYNPICO-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H21FO7/c1-15(29)25(16(2)30)35-26-23(33-14-17-6-4-3-5-7-17)13-21(32)24-20(31)12-22(34-27(24)26)18-8-10-19(28)11-9-18/h3-13,25,32H,14H2,1-2H3.
What are the key properties of 3-[2-(4-fluorophenyl)-5-hydroxy-4-oxo-7-phenylmethoxychromen-8-yl]oxypentane-2,4-dione?
3-[2-(4-fluorophenyl)-5-hydroxy-4-oxo-7-phenylmethoxychromen-8-yl]oxypentane-2,4-dione has a molecular weight of 476.46 g/mol, XLogP of 4.81, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(4-fluorophenyl)-5-hydroxy-4-oxo-7-phenylmethoxychromen-8-yl]oxypentane-2,4-dione is sourced from PubChem (CID 172693463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).