C27H21FO7 — CID 172693463
3-[2-(4-fluorophenyl)-5-hydroxy-4-oxo-7-phenylmethoxychromen-8-yl]oxypentane-2,4-dione (PubChem CID 172693463) has the molecular formula C27H21FO7 and a molecular weight of 476.46 g/mol. Its IUPAC name is 3-[2-(4-fluorophenyl)-5-hydroxy-4-oxo-7-phenylmethoxychromen-8-yl]oxypentane-2,4-dione.
| Compound Name | 3-[2-(4-fluorophenyl)-5-hydroxy-4-oxo-7-phenylmethoxychromen-8-yl]oxypentane-2,4-dione |
|---|---|
| PubChem CID | 172693463 |
| Molecular Formula | C27H21FO7 |
| Molecular Weight | 476.46 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | 3-[2-(4-fluorophenyl)-5-hydroxy-4-oxo-7-phenylmethoxychromen-8-yl]oxypentane-2,4-dione |
| SMILES | CC(=O)C(Oc1c(OCc2ccccc2)cc(O)c2c(=O)cc(-c3ccc(F)cc3)oc12)C(C)=O |
| InChI | InChI=1S/C27H21FO7/c1-15(29)25(16(2)30)35-26-23(33-14-17-6-4-3-5-7-17)13-21(32)24-20(31)12-22(34-27(24)26)18-8-10-19(28)11-9-18/h3-13,25,32H,14H2,1-2H3 |
| InChIKey | BZOFDIABYNPICO-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.46 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|