C33H24O3 — CID 102106371
4,9,14-tris(3-methylphenyl)-3,8,13-trioxatetracyclo[10.3.0.02,6.07,11]pentadeca-1,4,6,9,11,14-hexaene (PubChem CID 102106371) has the molecular formula C33H24O3 and a molecular weight of 468.55 g/mol. Its IUPAC name is 4,9,14-tris(3-methylphenyl)-3,8,13-trioxatetracyclo[10.3.0.02,6.07,11]pentadeca-1,4,6,9,11,14-hexaene.
| Compound Name | 4,9,14-tris(3-methylphenyl)-3,8,13-trioxatetracyclo[10.3.0.02,6.07,11]pentadeca-1,4,6,9,11,14-hexaene |
|---|---|
| PubChem CID | 102106371 |
| Molecular Formula | C33H24O3 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | 4,9,14-tris(3-methylphenyl)-3,8,13-trioxatetracyclo[10.3.0.02,6.07,11]pentadeca-1,4,6,9,11,14-hexaene |
| SMILES | Cc1cccc(-c2cc3c(o2)c2cc(-c4cccc(C)c4)oc2c2cc(-c4cccc(C)c4)oc32)c1 |
| InChI | InChI=1S/C33H24O3/c1-19-7-4-10-22(13-19)28-16-25-31(34-28)26-17-29(23-11-5-8-20(2)14-23)36-33(26)27-18-30(35-32(25)27)24-12-6-9-21(3)15-24/h4-18H,1-3H3 |
| InChIKey | HTUHLZRQFIUHMP-UHFFFAOYSA-N |
| XLogP | 9.85 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |