C23H26N2O2 — CID 166778749
8-(1-anilinoethyl)-6-methyl-2-piperidin-1-ylchromen-4-one (PubChem CID 166778749) has the molecular formula C23H26N2O2 and a molecular weight of 362.47 g/mol. Its IUPAC name is 8-(1-anilinoethyl)-6-methyl-2-piperidin-1-ylchromen-4-one.
| Compound Name | 8-(1-anilinoethyl)-6-methyl-2-piperidin-1-ylchromen-4-one |
|---|---|
| PubChem CID | 166778749 |
| Molecular Formula | C23H26N2O2 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | 8-(1-anilinoethyl)-6-methyl-2-piperidin-1-ylchromen-4-one |
| SMILES | Cc1cc(C(C)Nc2ccccc2)c2oc(N3CCCCC3)cc(=O)c2c1 |
| InChI | InChI=1S/C23H26N2O2/c1-16-13-19(17(2)24-18-9-5-3-6-10-18)23-20(14-16)21(26)15-22(27-23)25-11-7-4-8-12-25/h3,5-6,9-10,13-15,17,24H,4,7-8,11-12H2,1-2H3 |
| InChIKey | HAXZOVDNLJMUJP-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |