C23H21N3O4 — CID 156876758
2-[[(1R)-1-[2-(3-cyanoazetidin-1-yl)-6-methyl-4-oxochromen-8-yl]ethyl]amino]benzoic acid (PubChem CID 156876758) has the molecular formula C23H21N3O4 and a molecular weight of 403.44 g/mol. Its IUPAC name is 2-[[(1R)-1-[2-(3-cyanoazetidin-1-yl)-6-methyl-4-oxochromen-8-yl]ethyl]amino]benzoic acid.
| Compound Name | 2-[[(1R)-1-[2-(3-cyanoazetidin-1-yl)-6-methyl-4-oxochromen-8-yl]ethyl]amino]benzoic acid |
|---|---|
| PubChem CID | 156876758 |
| Molecular Formula | C23H21N3O4 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | 2-[[(1R)-1-[2-(3-cyanoazetidin-1-yl)-6-methyl-4-oxochromen-8-yl]ethyl]amino]benzoic acid |
| SMILES | Cc1cc([C@@H](C)Nc2ccccc2C(=O)O)c2oc(N3CC(C#N)C3)cc(=O)c2c1 |
| InChI | InChI=1S/C23H21N3O4/c1-13-7-17(14(2)25-19-6-4-3-5-16(19)23(28)29)22-18(8-13)20(27)9-21(30-22)26-11-15(10-24)12-26/h3-9,14-15,25H,11-12H2,1-2H3,(H,28,29)/t14-/m1/s1 |
| InChIKey | HTZJTQNKJSDQMU-CQSZACIVSA-N |
| XLogP | 3.93 |
| TPSA | 106.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |