C30H28N4O4 — CID 156876429
2-[[amino-[2-(4-cyano-4-phenylpiperidin-1-yl)-6-methyl-4-oxochromen-8-yl]methyl]amino]benzoic acid (PubChem CID 156876429) has the molecular formula C30H28N4O4 and a molecular weight of 508.58 g/mol. Its IUPAC name is 2-[[amino-[2-(4-cyano-4-phenylpiperidin-1-yl)-6-methyl-4-oxochromen-8-yl]methyl]amino]benzoic acid.
| Compound Name | 2-[[amino-[2-(4-cyano-4-phenylpiperidin-1-yl)-6-methyl-4-oxochromen-8-yl]methyl]amino]benzoic acid |
|---|---|
| PubChem CID | 156876429 |
| Molecular Formula | C30H28N4O4 |
| Molecular Weight | 508.58 g/mol |
| Exact Mass | 508.21 |
| IUPAC Name | 2-[[amino-[2-(4-cyano-4-phenylpiperidin-1-yl)-6-methyl-4-oxochromen-8-yl]methyl]amino]benzoic acid |
| SMILES | Cc1cc(C(N)Nc2ccccc2C(=O)O)c2oc(N3CCC(C#N)(c4ccccc4)CC3)cc(=O)c2c1 |
| InChI | InChI=1S/C30H28N4O4/c1-19-15-22-25(35)17-26(34-13-11-30(18-31,12-14-34)20-7-3-2-4-8-20)38-27(22)23(16-19)28(32)33-24-10-6-5-9-21(24)29(36)37/h2-10,15-17,28,33H,11-14,32H2,1H3,(H,36,37) |
| InChIKey | ZOMJCCCQLITVFA-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 132.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.58 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|