C24H25ClN2O4 — CID 156876446
2-[[(1R)-1-[2-(4-chloropiperidin-1-yl)-6-methyl-4-oxochromen-8-yl]ethyl]amino]benzoic acid (PubChem CID 156876446) has the molecular formula C24H25ClN2O4 and a molecular weight of 440.93 g/mol. Its IUPAC name is 2-[[(1R)-1-[2-(4-chloropiperidin-1-yl)-6-methyl-4-oxochromen-8-yl]ethyl]amino]benzoic acid.
| Compound Name | 2-[[(1R)-1-[2-(4-chloropiperidin-1-yl)-6-methyl-4-oxochromen-8-yl]ethyl]amino]benzoic acid |
|---|---|
| PubChem CID | 156876446 |
| Molecular Formula | C24H25ClN2O4 |
| Molecular Weight | 440.93 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | 2-[[(1R)-1-[2-(4-chloropiperidin-1-yl)-6-methyl-4-oxochromen-8-yl]ethyl]amino]benzoic acid |
| SMILES | Cc1cc([C@@H](C)Nc2ccccc2C(=O)O)c2oc(N3CCC(Cl)CC3)cc(=O)c2c1 |
| InChI | InChI=1S/C24H25ClN2O4/c1-14-11-18(15(2)26-20-6-4-3-5-17(20)24(29)30)23-19(12-14)21(28)13-22(31-23)27-9-7-16(25)8-10-27/h3-6,11-13,15-16,26H,7-10H2,1-2H3,(H,29,30)/t15-/m1/s1 |
| InChIKey | OYFFVPZLOCJKSB-OAHLLOKOSA-N |
| XLogP | 5.18 |
| TPSA | 82.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.93 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|