C18H15BrN4 — CID 15503660
2-amino-4-(4-bromophenyl)-6-pyrrolidin-1-ylbenzene-1,3-dicarbonitrile (PubChem CID 15503660) has the molecular formula C18H15BrN4 and a molecular weight of 367.25 g/mol. Its IUPAC name is 2-amino-4-(4-bromophenyl)-6-pyrrolidin-1-ylbenzene-1,3-dicarbonitrile.
| Compound Name | 2-amino-4-(4-bromophenyl)-6-pyrrolidin-1-ylbenzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 15503660 |
| Molecular Formula | C18H15BrN4 |
| Molecular Weight | 367.25 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | 2-amino-4-(4-bromophenyl)-6-pyrrolidin-1-ylbenzene-1,3-dicarbonitrile |
| SMILES | N#Cc1c(-c2ccc(Br)cc2)cc(N2CCCC2)c(C#N)c1N |
| InChI | InChI=1S/C18H15BrN4/c19-13-5-3-12(4-6-13)14-9-17(23-7-1-2-8-23)16(11-21)18(22)15(14)10-20/h3-6,9H,1-2,7-8,22H2 |
| InChIKey | LSLABHLOUILEMB-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 76.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.25 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|